ChemNet > CAS > 68003-13-4 (2-hidroksipropil)amonium dihidrogen ortoborat
68003-13-4 (2-hidroksipropil)amonium dihidrogen ortoborat
| Nama produk |
(2-hidroksipropil)amonium dihidrogen ortoborat |
| Sinonim |
;Isopropanolamine borat; Asam borat, compd.with 1-amino-2-propanol; MIPA-Borat; Monoisopropanolamine borat; 2-Hidroksipropilamonium ortoborat; (2-Hidroksipropil)amonium dihidrogen ortoborat; Asam borat (H3BO3), compd.dengan 1-amino-2-propanol (1:1) |
| Nama bahasa Inggris |
(2-hydroxypropyl)ammonium dihydrogen orthoborate; Isopropanolamine borate; Boric acid, compd. with 1-amino-2-propanol; MIPA-Borate; Monoisopropanolamine borate; 2-Hydroxypropylammonium orthoborate; (2-Hydroxypropyl)ammonium dihydrogen orthoborate; Boric acid (H3BO3), compd. with 1-amino-2-propanol (1:1) |
| MF |
C3H9NO・BH3O3 |
| Berat Molekul |
136.942 |
| InChI |
InChI=1/C3H9NO.BH3O3/c1-3(5)2-4;2-1(3)4/h3,5H,2,4H2,1H3;2-4H |
| CAS NO |
68003-13-4 |
| EINECS |
268-109-8 |
| Struktur Molekul |
|
|