6833-15-4 4-klorobenzanilid
| Nama produk |
4-klorobenzanilid |
| Sinonim |
4-kloro-N-fenilbenzamida |
| Nama bahasa Inggris |
4-chlorobenzanilide; 4-chloro-N-phenylbenzamide |
| MF |
C13H10ClNO |
| Berat Molekul |
231.6776 |
| InChI |
InChI=1/C13H10ClNO/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,(H,15,16) |
| CAS NO |
6833-15-4 |
| Struktur Molekul |
|
| Kepadatan |
1.285g/cm3 |
| Titik lebur |
199-201℃ |
| Titik didih |
288.6°C at 760 mmHg |
| Indeks bias |
1.649 |
| Titik nyala |
128.3°C |
| Tekanan uap |
0.00232mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|