ChemNet > CAS > 68441-68-9 Asam decanoic, ester campuran dengan asam oktanoat dan pentaerythritol
68441-68-9 Asam decanoic, ester campuran dengan asam oktanoat dan pentaerythritol
| Nama produk |
Asam decanoic, ester campuran dengan asam oktanoat dan pentaerythritol |
| Sinonim |
Pentaerythrityl tetracaprylate/caprate; Asam oktanoat, asam decanoic, pentaerythritol ester; Pentaerythritol asam kaprilat asam kaprat dicampur ester; Pentaerythritol, tetraester caprylate caprate; Rantai lurus jenuh (C8 dan C10) ester pentaerythritol asam lemak; 2,2-bis (hidroksimetil) propana-1,3-diol; asam decanoic; asam oktanoat |
| Nama bahasa Inggris |
Decanoic acid, mixed esters with octanoic acid and pentaerythritol;Pentaerythrityl tetracaprylate/caprate; Octanoic acid, decanoic acid, pentaerythritol ester; Pentaerythritol caprylic acid capric acid mixed esters; Pentaerythritol, caprylate caprate tetraester; Saturated straight chain (C8 and C10) fatty acid pentaerythritol ester; 2,2-bis(hydroxymethyl)propane-1,3-diol; decanoic acid; octanoic acid |
| MF |
C23H48O8 |
| Berat Molekul |
452.6224 |
| InChI |
InChI=1/C10H20O2.C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;6-1-5(2-7,3-8)4-9/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);6-9H,1-4H2 |
| CAS NO |
68441-68-9 |
| EINECS |
270-472-2 |
| Struktur Molekul |
|
| Titik didih |
269.6°C at 760 mmHg |
| Titik nyala |
121.8°C |
| Tekanan uap |
0.00355mmHg at 25°C |
|