ChemNet > CAS > 69225-59-8 1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle
69225-59-8 1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle
Nama produk |
1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle |
Nama bahasa Inggris |
1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle; 1,4-Cyclohexanedione mono-2,2-dimethyltrimethylene ketal; 3,3-dimethyl-1,5-dioxaspiro(5.5)undecan-9-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-8-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-9-one; 1,4-Cyclohexanedione Mono(2,2-Dimethyltrimethylene Ketal) |
MF |
C11H18O3 |
Berat Molekul |
198.2588 |
InChI |
InChI=1/C11H18O3/c1-10(2)7-13-11(14-8-10)5-3-9(12)4-6-11/h3-8H2,1-2H3 |
CAS NO |
69225-59-8 |
EINECS |
273-918-4 |
Struktur Molekul |
|
Kepadatan |
1.08g/cm3 |
Titik lebur |
45-50℃ |
Titik didih |
295.4°C at 760 mmHg |
Indeks bias |
1.484 |
Titik nyala |
123.3°C |
Tekanan uap |
0.00153mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|