ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
| Nama produk |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Nama bahasa Inggris |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate; Methyl 2,5-dimethylpyrrole-3-carboxylate |
| MF |
C8H11NO2 |
| Berat Molekul |
153.1784 |
| InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
| CAS NO |
69687-80-5 |
| Struktur Molekul |
|
| Kepadatan |
1.108g/cm3 |
| Titik lebur |
115℃ |
| Titik didih |
294.3°C at 760 mmHg |
| Indeks bias |
1.521 |
| Titik nyala |
131.8°C |
| Tekanan uap |
0.00163mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
