704-38-1 Bis(2-thienyl) ketone
Nama produk |
Bis(2-thienyl) ketone |
Nama bahasa Inggris |
Bis(2-thienyl) ketone; Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
MF |
C9H6OS2 |
Berat Molekul |
194.2733 |
InChI |
InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
CAS NO |
704-38-1 |
Struktur Molekul |
|
Kepadatan |
1.326g/cm3 |
Titik lebur |
89-91℃ |
Titik didih |
323°C at 760 mmHg |
Indeks bias |
1.64 |
Titik nyala |
149.1°C |
Tekanan uap |
0.00027mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|