7335-25-3 Ethyl 2-chlorobenzoate
Nama produk |
Ethyl 2-chlorobenzoate |
Nama bahasa Inggris |
Ethyl 2-chlorobenzoate; 2-Chlorobenzoic acid ethyl ester |
MF |
C9H9ClO2 |
Berat Molekul |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
CAS NO |
7335-25-3 |
EINECS |
230-842-6 |
Struktur Molekul |
|
Kepadatan |
1.185g/cm3 |
Titik didih |
243.6°C at 760 mmHg |
Indeks bias |
1.522 |
Titik nyala |
111.2°C |
Tekanan uap |
0.0318mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|