ChemNet > CAS > 74003-55-7 3,4-Dibromobenzaldehyde
74003-55-7 3,4-Dibromobenzaldehyde
Nama produk |
3,4-Dibromobenzaldehyde |
Nama bahasa Inggris |
3,4-Dibromobenzaldehyde; 3,4-Dibromo-benzaldehyde |
MF |
C7H4Br2O |
Berat Molekul |
263.9141 |
InChI |
InChI=1/C7H4Br2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
CAS NO |
74003-55-7 |
Struktur Molekul |
|
Kepadatan |
1.977g/cm3 |
Titik didih |
303.6°C at 760 mmHg |
Indeks bias |
1.645 |
Titik nyala |
123°C |
Tekanan uap |
0.00092mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|