ChemNet > CAS > 74896-66-5 methyl 3,5-dibromo-4-methylbenzoate
74896-66-5 methyl 3,5-dibromo-4-methylbenzoate
Nama produk |
methyl 3,5-dibromo-4-methylbenzoate |
Nama bahasa Inggris |
methyl 3,5-dibromo-4-methylbenzoate; 3,5-Dibromo-4-methylbenzoic acid methyl ester; 3,5-Dibromo-p-toluic acid methyl ester (COOCH3=1) |
MF |
C9H8Br2O2 |
Berat Molekul |
307.9666 |
InChI |
InChI=1/C9H8Br2O2/c1-5-7(10)3-6(4-8(5)11)9(12)13-2/h3-4H,1-2H3 |
CAS NO |
74896-66-5 |
Struktur Molekul |
|
Kepadatan |
1.75g/cm3 |
Titik didih |
314°C at 760 mmHg |
Indeks bias |
1.575 |
Titik nyala |
143.7°C |
Tekanan uap |
0.000478mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|