ChemNet > CAS > 7499-07-2 4-Chloro-2-methylbenzoic acid
7499-07-2 4-Chloro-2-methylbenzoic acid
Nama produk |
4-Chloro-2-methylbenzoic acid |
Nama bahasa Inggris |
4-Chloro-2-methylbenzoic acid; |
MF |
C8H7ClO2 |
Berat Molekul |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
CAS NO |
7499-07-2 |
Struktur Molekul |
|
Kepadatan |
1.31g/cm3 |
Titik lebur |
180℃ |
Titik didih |
300.3°C at 760 mmHg |
Indeks bias |
1.573 |
Titik nyala |
135.4°C |
Tekanan uap |
0.000504mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|