ChemNet > CAS > 7541-49-3 Fitol
7541-49-3 Fitol
| Nama produk |
Fitol |
| Sinonim |
; 2-heksadesen-1-ol, 3,7,11,15-tetrametil-; 3,7,11,15-tetramethylhexadec-2-en-1-ol |
| Nama bahasa Inggris |
Phytol; 2-hexadecen-1-ol, 3,7,11,15-tetramethyl-; 3,7,11,15-Tetramethylhexadec-2-en-1-ol |
| MF |
C20H40O |
| Berat Molekul |
296.531 |
| InChI |
InChI=1/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3 |
| CAS NO |
7541-49-3 |
| Struktur Molekul |
|
| Kepadatan |
0.845g/cm3 |
| Titik didih |
335.5°C at 760 mmHg |
| Indeks bias |
1.459 |
| Titik nyala |
157.5°C |
| Tekanan uap |
8.32E-06mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
