ChemNet > CAS > 758-16-7 N,N-Dimethylthioformamide
758-16-7 N,N-Dimethylthioformamide
| Nama produk |
N,N-Dimethylthioformamide |
| Nama bahasa Inggris |
N,N-Dimethylthioformamide; NN-Dimethylthioformamide |
| MF |
C3H7NS |
| Berat Molekul |
89.1594 |
| InChI |
InChI=1/C3H7NS/c1-4(2)3-5/h3H,1-2H3 |
| CAS NO |
758-16-7 |
| EINECS |
212-060-7 |
| Struktur Molekul |
|
| Kepadatan |
0.985g/cm3 |
| Titik didih |
224.9°C at 760 mmHg |
| Indeks bias |
1.511 |
| Titik nyala |
89.8°C |
| Tekanan uap |
0.089mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
