ChemNet > CAS > 7605-25-6 Ethyl (phenylthio)acetate
7605-25-6 Ethyl (phenylthio)acetate
| Nama produk |
Ethyl (phenylthio)acetate |
| Nama bahasa Inggris |
Ethyl (phenylthio)acetate; Ethyl 2-(phenylthio)acetate; ethyl (phenylsulfanyl)acetate; 2-(phenylsulfanyl)butanoic acid |
| MF |
C10H12O2S |
| Berat Molekul |
196.2661 |
| InChI |
InChI=1/C10H12O2S/c1-2-9(10(11)12)13-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12) |
| CAS NO |
7605-25-6 |
| Struktur Molekul |
|
| Kepadatan |
1.18g/cm3 |
| Titik didih |
330.3°C at 760 mmHg |
| Indeks bias |
1.579 |
| Titik nyala |
153.5°C |
| Tekanan uap |
6.74E-05mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
