ChemNet > CAS > 7697-29-2 4-Chloro-3-methylbenzoic acid
7697-29-2 4-Chloro-3-methylbenzoic acid
| Nama produk |
4-Chloro-3-methylbenzoic acid |
| Nama bahasa Inggris |
4-Chloro-3-methylbenzoic acid; 3-Methyl -4-Chlorobenzoic acid; 3-methyl-4-chlorobenzoic acid; 4-CHLORO-M-TOLUIC ACID; 4-Chloro-3-toluic acid; 4-Chloro-3-Methyl |
| MF |
C8H7ClO2 |
| Berat Molekul |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
| CAS NO |
7697-29-2 |
| Struktur Molekul |
|
| Kepadatan |
1.31g/cm3 |
| Titik didih |
299°C at 760 mmHg |
| Indeks bias |
1.573 |
| Titik nyala |
134.6°C |
| Tekanan uap |
0.000548mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
