ChemNet > CAS > 78881-21-7 4-Amino-3-methylbenzonitrile
78881-21-7 4-Amino-3-methylbenzonitrile
| Nama produk |
4-Amino-3-methylbenzonitrile |
| Nama bahasa Inggris |
4-Amino-3-methylbenzonitrile; 4-Amino-m-tolunitrile; 4-Cyano-o-toluidine; 3-Methyl-4-aminobenzonitrile |
| MF |
C8H8N2 |
| Berat Molekul |
132.1625 |
| InChI |
InChI=1/C8H8N2/c1-6-4-7(5-9)2-3-8(6)10/h2-4H,10H2,1H3 |
| CAS NO |
78881-21-7 |
| Struktur Molekul |
|
| Kepadatan |
1.1g/cm3 |
| Titik didih |
304.5°C at 760 mmHg |
| Indeks bias |
1.575 |
| Titik nyala |
138°C |
| Tekanan uap |
0.000869mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
