Nama produk |
(1R, 2S, 3R, 4R) -2,3-Dihidroksi-4- (hidroksimetil) -1-aminosiklopentana hidroklorida |
Sinonim |
(1R,2S,3R,5R)-3-amino-5-(hidroksimetil)siklopentana-1,2-diol hidroklorida; (1R,2S,3R,4R)-2,3-dihidroksi-4-(hidroksimetil)siklopentanaminium |
Nama bahasa Inggris |
(1R,2S,3R,4R)-2,3-Dihydroxy-4-(hydroxymethyl)-1-aminocyclopentane hydrochloride;(1R,2S,3R,5R)-3-amino-5-(hydroxymethyl)cyclopentane-1,2-diol hydrochloride; (1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentanaminium |
MF |
C6H14NO3 |
Berat Molekul |
148.1797 |
InChI |
InChI=1/C6H13NO3/c7-4-1-3(2-8)5(9)6(4)10/h3-6,8-10H,1-2,7H2/p+1/t3-,4-,5-,6+/m1/s1 |
CAS NO |
79200-57-0 |
Struktur Molekul |
|
Titik didih |
300.855°C at 760 mmHg |
Titik nyala |
135.752°C |
Tekanan uap |
0mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|