ChemNet > CAS > 80789-69-1 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid
80789-69-1 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid
Nama produk |
1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid |
Nama bahasa Inggris |
1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid;1-(4-Chlorophenyl)cyclopentanecarboxylic acid; 1-(4-chlorophenyl)cyclopentanecarboxylate |
MF |
C12H12ClO2 |
Berat Molekul |
223.676 |
InChI |
InChI=1/C12H13ClO2/c13-10-5-3-9(4-6-10)12(11(14)15)7-1-2-8-12/h3-6H,1-2,7-8H2,(H,14,15)/p-1 |
CAS NO |
80789-69-1 |
EINECS |
279-552-1 |
Struktur Molekul |
|
Titik lebur |
160-164℃ |
Titik didih |
364.6°C at 760 mmHg |
Titik nyala |
174.3°C |
Tekanan uap |
5.9E-06mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|