813-56-9 Malonat-d2 asam-d2
Nama produk |
Malonat-d2 asam-d2 |
Sinonim |
; Asam malonat-d4; (~ 2 ~ H_2_) propana (~ 2 ~ H_2_) asam dioat |
Nama bahasa Inggris |
Malonic-d2 acid-d2; Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
MF |
C3D4O4 |
Berat Molekul |
108.0861 |
InChI |
InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
CAS NO |
813-56-9 |
EINECS |
212-385-4 |
Struktur Molekul |
|
Kepadatan |
1.605g/cm3 |
Titik lebur |
130-132℃ |
Titik didih |
386.8°C at 760 mmHg |
Indeks bias |
1.478 |
Titik nyala |
201.9°C |
Tekanan uap |
4.66E-07mmHg at 25°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|