ChemNet > CAS > 827-88-3 alpha-Cyclopropyl-4-fluorobenzyl alcohol
827-88-3 alpha-Cyclopropyl-4-fluorobenzyl alcohol
Nama produk |
alpha-Cyclopropyl-4-fluorobenzyl alcohol |
Nama bahasa Inggris |
alpha-Cyclopropyl-4-fluorobenzyl alcohol; Cyclopropyl(4-fluorophenyl)methanol; (R)-cyclopropyl(4-fluorophenyl)methanol; (S)-cyclopropyl(4-fluorophenyl)methanol |
MF |
C10H11FO |
Berat Molekul |
166.1921 |
InChI |
InChI=1/C10H11FO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7,10,12H,1-2H2/t10-/m0/s1 |
CAS NO |
827-88-3 |
EINECS |
212-576-2 |
Struktur Molekul |
|
Kepadatan |
1.24g/cm3 |
Titik didih |
250.8°C at 760 mmHg |
Indeks bias |
1.578 |
Titik nyala |
128.9°C |
Tekanan uap |
0.0111mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|