ChemNet > CAS > 82796-69-8 (S)-1-(3-Methoxyphenyl)ethylamine
82796-69-8 (S)-1-(3-Methoxyphenyl)ethylamine
| Nama produk |
(S)-1-(3-Methoxyphenyl)ethylamine |
| Nama bahasa Inggris |
(S)-1-(3-Methoxyphenyl)ethylamine; (S)-m-Methoxy-alpha-methylbenzylamine; (1S)-1-(3-methoxyphenyl)ethanamine |
| MF |
C9H13NO |
| Berat Molekul |
151.2056 |
| InChI |
InChI=1/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m0/s1 |
| CAS NO |
82796-69-8 |
| Struktur Molekul |
|
| Kepadatan |
1.003g/cm3 |
| Titik didih |
234.6°C at 760 mmHg |
| Indeks bias |
1.522 |
| Titik nyala |
94.7°C |
| Tekanan uap |
0.0524mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R21/22:Harmful in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
