ChemNet > CAS > 84347-67-1 cis-N-(4-Chlorobutenyl)phthalimide
84347-67-1 cis-N-(4-Chlorobutenyl)phthalimide
Nama produk |
cis-N-(4-Chlorobutenyl)phthalimide |
Nama bahasa Inggris |
cis-N-(4-Chlorobutenyl)phthalimide;2-[(2Z)-4-chlorobut-2-en-1-yl]-1H-isoindole-1,3(2H)-dione |
MF |
C12H10ClNO2 |
Berat Molekul |
235.6663 |
InChI |
InChI=1/C12H10ClNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-6H,7-8H2/b4-3- |
CAS NO |
84347-67-1 |
Struktur Molekul |
|
Kepadatan |
1.322g/cm3 |
Titik lebur |
79℃ |
Titik didih |
374.2°C at 760 mmHg |
Indeks bias |
1.602 |
Titik nyala |
180.1°C |
Tekanan uap |
8.52E-06mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|