ChemNet > CAS > 844-51-9 2,5-Diphenyl-p-benzoquinone
844-51-9 2,5-Diphenyl-p-benzoquinone
Nama produk |
2,5-Diphenyl-p-benzoquinone |
Nama bahasa Inggris |
2,5-Diphenyl-p-benzoquinone;2,5-Diphenyl-4-benzoquinone; 2,5-Diphenyl-1,4-benzoquinone; AI3-61046; NSC 8725; 2,5-Cyclohexadiene-1,4-dione, 2,5-diphenyl-; p-Benzoquinone, 2,5-diphenyl- (8CI); 2,5-diphenylcyclohexa-2,5-diene-1,4-dione |
MF |
C18H12O2 |
Berat Molekul |
260.2867 |
InChI |
InChI=1/C18H12O2/c19-17-12-16(14-9-5-2-6-10-14)18(20)11-15(17)13-7-3-1-4-8-13/h1-12H |
CAS NO |
844-51-9 |
EINECS |
212-680-8 |
Struktur Molekul |
|
Kepadatan |
1.237g/cm3 |
Titik didih |
457.9°C at 760 mmHg |
Indeks bias |
1.642 |
Titik nyala |
170.5°C |
Tekanan uap |
1.43E-08mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|