| Nama produk |
Klorfenak |
| Sinonim |
; Asam 2,3,6-Trichlorophenylacetic; Klorfenak [BSI:ISO]; 2,3,6-TCA; Asam 2,3,6-Trichlorobenzeneacetic; 2,3,6-Trichlorophenyl acetic acid; 2,3,6-Trichlorphenylessigsaeure; 2,3,6-Trichlorphenylessigsaeure [Jerman]; 4-09-00-01681 (Referensi Buku Pegangan Beilstein); Asam asetat, (2,3,6-triklorofenil)-; BRN 2113332; Asam benzenaasetat, 2,3,6-trikloro-; Caswell: Tidak.882; EINECS 201-599-3; Kode Kimia Pestisida EPA 082601; Fenac; Fenae; Fenatrol; HSDB 3434; Kanepar; Kyselina 2,3,6-triklorfenyloctova; Kyselina 2,3,6-triklorfenyloctova [Ceko]; NSC 41931; Tri fene; Tri-fen; Trifene; (2,3,6-triklorofenil)asetat |
| Nama bahasa Inggris |
Chlorfenac; 2,3,6-Trichlorophenylacetic acid; Chlorfenac [BSI:ISO]; 2,3,6-TCA; 2,3,6-Trichlorobenzeneacetic acid; 2,3,6-Trichlorophenyl acetic acid; 2,3,6-Trichlorphenylessigsaeure; 2,3,6-Trichlorphenylessigsaeure [German]; 4-09-00-01681 (Beilstein Handbook Reference); Acetic acid, (2,3,6-trichlorophenyl)-; BRN 2113332; Benzeneacetic acid, 2,3,6-trichloro-; Caswell No. 882; EINECS 201-599-3; EPA Pesticide Chemical Code 082601; Fenac; Fenae; Fenatrol; HSDB 3434; Kanepar; Kyselina 2,3,6-trichlorfenyloctova; Kyselina 2,3,6-trichlorfenyloctova [Czech]; NSC 41931; Tri fene; Tri-fen; Trifene; (2,3,6-trichlorophenyl)acetate |
| MF |
C8H4Cl3O2 |
| Berat Molekul |
238.4757 |
| InChI |
InChI=1/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13)/p-1 |
| CAS NO |
85-34-7 |
| EINECS |
201-599-3 |
| Struktur Molekul |
|
| Titik didih |
353.5°C at 760 mmHg |
| Titik nyala |
167.6°C |
| Tekanan uap |
1.32E-05mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R22:Harmful if swallowed.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Keselamatan Deskripsi |
S36:Wear suitable protective clothing.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
