ChemNet > CAS > 86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
| Nama produk |
5-nitro-1-benzothiophene-2-carbonyl chloride |
| Nama bahasa Inggris |
5-nitro-1-benzothiophene-2-carbonyl chloride; |
| MF |
C9H4ClNO3S |
| Berat Molekul |
241.651 |
| InChI |
InChI=1/C9H4ClNO3S/c10-9(12)8-4-5-3-6(11(13)14)1-2-7(5)15-8/h1-4H |
| CAS NO |
86010-32-4 |
| Struktur Molekul |
|
| Kepadatan |
1.597g/cm3 |
| Titik lebur |
158℃ |
| Titik didih |
401.7°C at 760 mmHg |
| Indeks bias |
1.712 |
| Titik nyala |
196.7°C |
| Tekanan uap |
1.16E-06mmHg at 25°C |
| Simbol bahaya |
 C:Corrosive;
|
| Kode Risiko |
R34:Causes burns.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
