ChemNet > CAS > 86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
| Nama produk |
ethyl 2,4-dichloro-6-methylnicotinate |
| Nama bahasa Inggris |
ethyl 2,4-dichloro-6-methylnicotinate; ethyl 2,4-dichloro-6-methylpyridine-3-carboxylate; 2,4-dichloro-6-methylpyridine-3-carboxylate |
| MF |
C9H9Cl2NO2 |
| Berat Molekul |
234.0793 |
| InChI |
InChI=1/C9H9Cl2NO2/c1-3-14-9(13)7-6(10)4-5(2)12-8(7)11/h4H,3H2,1-2H3 |
| CAS NO |
86129-63-7 |
| Struktur Molekul |
|
| Kepadatan |
1.32g/cm3 |
| Titik lebur |
56℃ |
| Titik didih |
298.2°C at 760 mmHg |
| Indeks bias |
1.537 |
| Titik nyala |
134.1°C |
| Tekanan uap |
0.00129mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
