865-49-6 Chloroform-d
Nama produk |
Chloroform-d |
Nama bahasa Inggris |
Chloroform-d; Chloroform-d+1% TMs (v/v); chloroform-D 99.8 atom % D*contains 1% tms; Chloroformdisotopicpuritytetramethylsilane; Chloroform-d + 0.05% TMS (v/v); Chloroformdiosotopicpurity; Chloroform D1; trichloro(~2~H)methane |
MF |
CDCl3 |
Berat Molekul |
120.3838 |
InChI |
InChI=1/CHCl3/c2-1(3)4/h1H/i1D |
CAS NO |
865-49-6 |
EINECS |
212-742-4 |
Struktur Molekul |
|
Kepadatan |
1.512g/cm3 |
Titik lebur |
-64℃ |
Titik didih |
61.2°C at 760 mmHg |
Indeks bias |
1.445 |
Tekanan uap |
200mmHg at 25°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R22:Harmful if swallowed.;
R38:Irritating to skin.;
R40:Possible risks of irreversible effects.;
R48/20/22:Harmful : danger of serious damage to health by prolonged exposure through inhalation and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|