ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
| Nama produk |
2-Chloro-6-fluoroacetophenone |
| Nama bahasa Inggris |
2-Chloro-6-fluoroacetophenone;1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
| MF |
C8H6ClFO |
| Berat Molekul |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| CAS NO |
87327-69-3 |
| Struktur Molekul |
|
| Kepadatan |
1.258g/cm3 |
| Titik didih |
191.8°C at 760 mmHg |
| Indeks bias |
1.512 |
| Titik nyala |
69.8°C |
| Tekanan uap |
0.506mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
