ChemNet > CAS > 875-59-2 4'-Hydroxy-2'-methylacetophenone
875-59-2 4'-Hydroxy-2'-methylacetophenone
| Nama produk |
4'-Hydroxy-2'-methylacetophenone |
| Nama bahasa Inggris |
4'-Hydroxy-2'-methylacetophenone; 2'-Methyl-4'-hydroxyacetophenone |
| MF |
C9H10O2 |
| Berat Molekul |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-6-5-8(11)3-4-9(6)7(2)10/h3-5,11H,1-2H3 |
| CAS NO |
875-59-2 |
| EINECS |
212-874-2 |
| Struktur Molekul |
|
| Kepadatan |
1.106g/cm3 |
| Titik lebur |
127-132℃ |
| Titik didih |
313°C at 760 mmHg |
| Indeks bias |
1.546 |
| Titik nyala |
127.9°C |
| Tekanan uap |
0.000278mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
