ChemNet > CAS > 877-43-0 2,6-Dimethylquinoline
877-43-0 2,6-Dimethylquinoline
| Nama produk |
2,6-Dimethylquinoline |
| Nama bahasa Inggris |
2,6-Dimethylquinoline; 6-METHYLQUINALDINE; 2,6-dimethyl-quinolin; P-TOLUQUINALDINE; Quinoline, 2,6-dimethyl- |
| MF |
C11H11N |
| Berat Molekul |
157.2117 |
| InChI |
InChI=1/C11H11N/c1-8-3-6-11-10(7-8)5-4-9(2)12-11/h3-7H,1-2H3 |
| CAS NO |
877-43-0 |
| EINECS |
212-891-5 |
| Struktur Molekul |
|
| Kepadatan |
1.052g/cm3 |
| Titik lebur |
56-60 °C |
| Titik didih |
266.5°C at 760 mmHg |
| Indeks bias |
1.61 |
| Titik nyala |
106.5°C |
| Tekanan uap |
0.0142mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
