ChemNet > CAS > 89581-82-8 2-Acetyl-3-chlorothiophene
89581-82-8 2-Acetyl-3-chlorothiophene
Nama produk |
2-Acetyl-3-chlorothiophene |
Nama bahasa Inggris |
2-Acetyl-3-chlorothiophene;1-(3-chlorothiophen-2-yl)ethanone |
MF |
C6H5ClOS |
Berat Molekul |
160.6213 |
InChI |
InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
CAS NO |
89581-82-8 |
Struktur Molekul |
|
Kepadatan |
1.312g/cm3 |
Titik didih |
219.9°C at 760 mmHg |
Indeks bias |
1.559 |
Titik nyala |
86.8°C |
Tekanan uap |
0.116mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|