ChemNet > CAS > 90002-36-1 2-Ethylbenzeneboronic acid
90002-36-1 2-Ethylbenzeneboronic acid
| Nama produk |
2-Ethylbenzeneboronic acid |
| Nama bahasa Inggris |
2-Ethylbenzeneboronic acid; 2-Ethylphenylboronic acid; RNase A |
| MF |
C8H11BO2 |
| Berat Molekul |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3 |
| CAS NO |
90002-36-1 |
| Struktur Molekul |
|
| Kepadatan |
1.07g/cm3 |
| Titik lebur |
102.5-107.5℃ |
| Titik didih |
299.1°C at 760 mmHg |
| Indeks bias |
1.521 |
| Titik nyala |
134.7°C |
| Tekanan uap |
0.000544mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
