ChemNet > CAS > 9009-54-5 Polyurethane
9009-54-5 Polyurethane
| Nama produk |
Polyurethane |
| Nama bahasa Inggris |
Polyurethane; Polyurethane foam; Polyurethane foams; Polyisocyanurate resins; Polyurethanes, cellular; PU foam; The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.; POLYURETHANEOLIGOMERS; POLYURETHANEVARNISH; PU; Acrylic polyurethane paint; Acrylic polyurethane anticorrosive coating; Polyurethane mixed component; 1-ethylurea |
| MF |
C3H8N2O |
| Berat Molekul |
88.1084 |
| InChI |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
| CAS NO |
9009-54-5 |
| EINECS |
210-898-8 |
| Struktur Molekul |
|
| Kepadatan |
1.005g/cm3 |
| Titik didih |
136.3°C at 760 mmHg |
| Indeks bias |
1.44 |
| Titik nyala |
36.2°C |
| Tekanan uap |
7.44mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
|
|
