9009-54-5 Polyurethane
Nama produk |
Polyurethane |
Nama bahasa Inggris |
Polyurethane; Polyurethane foam; Polyurethane foams; Polyisocyanurate resins; Polyurethanes, cellular; PU foam; The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.; POLYURETHANEOLIGOMERS; POLYURETHANEVARNISH; PU; Acrylic polyurethane paint; Acrylic polyurethane anticorrosive coating; Polyurethane mixed component; 1-ethylurea |
MF |
C3H8N2O |
Berat Molekul |
88.1084 |
InChI |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
CAS NO |
9009-54-5 |
EINECS |
210-898-8 |
Struktur Molekul |
|
Kepadatan |
1.005g/cm3 |
Titik didih |
136.3°C at 760 mmHg |
Indeks bias |
1.44 |
Titik nyala |
36.2°C |
Tekanan uap |
7.44mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
|
|