ChemNet > CAS > 90259-31-7 2-Bromo-6-methylbenzoic acid
90259-31-7 2-Bromo-6-methylbenzoic acid
| Nama produk |
2-Bromo-6-methylbenzoic acid |
| Nama bahasa Inggris |
2-Bromo-6-methylbenzoic acid; 6-Bromo-o-toluic acid |
| MF |
C8H7BrO2 |
| Berat Molekul |
215.044 |
| InChI |
InChI=1/C8H7BrO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| CAS NO |
90259-31-7 |
| Struktur Molekul |
|
| Kepadatan |
1.6g/cm3 |
| Titik lebur |
108-112℃ |
| Titik didih |
307.043°C at 760 mmHg |
| Indeks bias |
1.595 |
| Titik nyala |
139.495°C |
| Tekanan uap |
0mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R22:;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
