ChemNet > CAS > 493-01-6;91-17-8 cis-Decahydronaphthalene
493-01-6;91-17-8 cis-Decahydronaphthalene
| Nama produk |
cis-Decahydronaphthalene |
| Nama bahasa Inggris |
cis-Decahydronaphthalene; cis-bicyclo(4.4.0)decane; cis-decaline; Decahydronaphthalene; Deca hydro naphthalene; Decalin |
| MF |
C10H18 |
| Berat Molekul |
138.2499 |
| InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
| CAS NO |
493-01-6;91-17-8 |
| EINECS |
202-046-9 |
| Struktur Molekul |
|
| Kepadatan |
0.873g/cm3 |
| Titik lebur |
-31℃ |
| Titik didih |
190.879°C at 760 mmHg |
| Indeks bias |
1.47 |
| Titik nyala |
57.222°C |
| Kelarutan air |
6 mg/L at 20℃ |
| Tekanan uap |
0.735mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
