933-75-5 2,3,6-Trichlorophenol
Nama produk |
2,3,6-Trichlorophenol |
Nama bahasa Inggris |
2,3,6-Trichlorophenol; |
MF |
C6H3Cl3O |
Berat Molekul |
197.4464 |
InChI |
InChI=1/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
CAS NO |
933-75-5 |
EINECS |
213-271-7 |
Struktur Molekul |
|
Kepadatan |
1.596g/cm3 |
Titik lebur |
53-57℃ |
Titik didih |
230.6°C at 760 mmHg |
Indeks bias |
1.608 |
Titik nyala |
93.3°C |
Tekanan uap |
0.043mmHg at 25°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|