94-46-2 isopentyl benzoate
Nama produk |
isopentyl benzoate |
Nama bahasa Inggris |
isopentyl benzoate; Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
MF |
C12H16O2 |
Berat Molekul |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
CAS NO |
94-46-2 |
EINECS |
202-334-4 |
Struktur Molekul |
|
Kepadatan |
0.992g/cm3 |
Titik didih |
260°C at 760 mmHg |
Indeks bias |
1.495 |
Titik nyala |
109.4°C |
Tekanan uap |
0.0125mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|