ChemNet > CAS > 94-86-0 trans-2-ethoxy-5-(1-propenyl)phenol
94-86-0 trans-2-ethoxy-5-(1-propenyl)phenol
| Nama produk |
trans-2-ethoxy-5-(1-propenyl)phenol |
| Nama bahasa Inggris |
trans-2-ethoxy-5-(1-propenyl)phenol; 2-Ethoxy-5-prop-1-enylphenol; 5-propenylguaethol; Vanitrope; 2-ethoxy-5-(prop-1-en-1-yl)phenol; 2-ethoxy-5-[(1E)-prop-1-en-1-yl]phenol; Propenyl guaethol |
| MF |
C11H14O2 |
| Berat Molekul |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-3-5-9-6-7-11(13-4-2)10(12)8-9/h3,5-8,12H,4H2,1-2H3/b5-3+ |
| CAS NO |
94-86-0 |
| EINECS |
202-370-0 |
| Struktur Molekul |
|
| Kepadatan |
1.052g/cm3 |
| Titik lebur |
86-88℃ |
| Titik didih |
312.8°C at 760 mmHg |
| Indeks bias |
1.567 |
| Titik nyala |
165.2°C |
| Tekanan uap |
0.000281mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
