ChemNet > CAS > 943-93-1 1,2-Epoxy-5,9-cyclododecadiene
943-93-1 1,2-Epoxy-5,9-cyclododecadiene
Nama produk |
1,2-Epoxy-5,9-cyclododecadiene |
Nama bahasa Inggris |
1,2-Epoxy-5,9-cyclododecadiene; |
MF |
C12H18O |
Berat Molekul |
178.2707 |
InChI |
InChI=1/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3+,6-4+ |
CAS NO |
943-93-1 |
EINECS |
213-407-5 |
Struktur Molekul |
|
Kepadatan |
0.941g/cm3 |
Titik didih |
269.8°C at 760 mmHg |
Indeks bias |
1.484 |
Titik nyala |
113.6°C |
Tekanan uap |
0.0118mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|