ChemNet > CAS > 98437-24-2 Benzo(b)furan-2-boronic acid
98437-24-2 Benzo(b)furan-2-boronic acid
Nama produk |
Benzo(b)furan-2-boronic acid |
Nama bahasa Inggris |
Benzo(b)furan-2-boronic acid; Benzofuran-2-boronic acid; Benzo[b]furan-2-boronic acid; 1-Benzofuran-2-ylboronic acid; Benzofuran-2-ylboronic acid |
MF |
C8H7BO3 |
Berat Molekul |
161.9504 |
InChI |
InChI=1/C8H7BO3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H |
CAS NO |
98437-24-2 |
Struktur Molekul |
|
Kepadatan |
1.31g/cm3 |
Titik lebur |
114-116℃ |
Titik didih |
340.4°C at 760 mmHg |
Indeks bias |
1.618 |
Titik nyala |
159.7°C |
Tekanan uap |
3.33E-05mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|