10047-28-6 butyl thioglycolate
שם המוצר |
butyl thioglycolate |
שם אנגלי |
butyl thioglycolate; |
מולקולרית פורמולה |
C6H12O2S |
משקל מולקולרי |
148.2233 |
InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
מספר CAS |
10047-28-6 |
EINECS |
233-156-5 |
מבנה מולקולרי |
|
צפיפות |
1.088g/cm3 |
נקודת רתיחה |
220.125°C at 760 mmHg |
משקל סגולי |
1.491 |
נקודת הבזק |
86.929°C |
לחץ אדים |
0.024mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|