ChemNet > CAS > 102-38-5 3-Nitroformanilide
102-38-5 3-Nitroformanilide
| שם המוצר |
3-Nitroformanilide |
| שם אנגלי |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
| מולקולרית פורמולה |
C7H6N2O3 |
| משקל מולקולרי |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| מספר CAS |
102-38-5 |
| מבנה מולקולרי |
|
| צפיפות |
1.407g/cm3 |
| נקודת רתיחה |
368.5°C at 760 mmHg |
| משקל סגולי |
1.641 |
| נקודת הבזק |
176.7°C |
| לחץ אדים |
1.27E-05mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
