102-38-5 3-Nitroformanilide
שם המוצר |
3-Nitroformanilide |
שם אנגלי |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
מולקולרית פורמולה |
C7H6N2O3 |
משקל מולקולרי |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
מספר CAS |
102-38-5 |
מבנה מולקולרי |
|
צפיפות |
1.407g/cm3 |
נקודת רתיחה |
368.5°C at 760 mmHg |
משקל סגולי |
1.641 |
נקודת הבזק |
176.7°C |
לחץ אדים |
1.27E-05mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|