ChemNet > CAS > 1069-57-4 גואנידין, תרכובת עם nitrosopropanedinitrile (1: 1)
1069-57-4 גואנידין, תרכובת עם nitrosopropanedinitrile (1: 1)
שם המוצר |
גואנידין, תרכובת עם nitrosopropanedinitrile (1: 1) |
נרדפות |
Guanidine, תרכובת עם nitrosopropanedinitrile (1: 1); גואנידין - Nitrosopropanedinitrile (1: 1) |
שם אנגלי |
guanidine, compound with nitrosopropanedinitrile (1:1);Guanidine, compound with nitrosopropanedinitrile (1:1); guanidine - nitrosopropanedinitrile (1:1) |
מולקולרית פורמולה |
C4H6N6O |
משקל מולקולרי |
154.13 |
InChI |
InChI=1/C3HN3O.CH5N3/c4-1-3(2-5)6-7;2-1(3)4/h3H;(H5,2,3,4) |
מספר CAS |
1069-57-4 |
EINECS |
213-959-7 |
מבנה מולקולרי |
|
נקודת רתיחה |
173.7°C at 760 mmHg |
נקודת הבזק |
58.9°C |
לחץ אדים |
1.25mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
|
|