ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
שם המוצר |
2,6-Dibromo-4-nitrotoluene |
שם אנגלי |
2,6-Dibromo-4-nitrotoluene;1,3-dibromo-2-methyl-5-nitrobenzene |
מולקולרית פורמולה |
C7H5Br2NO2 |
משקל מולקולרי |
294.9281 |
InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
מספר CAS |
110127-07-6 |
מבנה מולקולרי |
|
צפיפות |
1.967g/cm3 |
נקודת רתיחה |
320.4°C at 760 mmHg |
משקל סגולי |
1.625 |
נקודת הבזק |
147.6°C |
לחץ אדים |
0.000598mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|