ChemNet > CAS > 110407-59-5 1-Bromo-2-chloro-4-fluorobenzene
110407-59-5 1-Bromo-2-chloro-4-fluorobenzene
| שם המוצר |
1-Bromo-2-chloro-4-fluorobenzene |
| שם אנגלי |
1-Bromo-2-chloro-4-fluorobenzene; 4-Bromo-3-chlorofluorobenzene; 2-Chloro-4-Fluorobromobenzene |
| מולקולרית פורמולה |
C6H3BrClF |
| משקל מולקולרי |
209.4434 |
| InChI |
InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| מספר CAS |
110407-59-5 |
| מבנה מולקולרי |
|
| צפיפות |
1.719g/cm3 |
| נקודת רתיחה |
196.3°C at 760 mmHg |
| משקל סגולי |
1.55 |
| נקודת הבזק |
72.5°C |
| לחץ אדים |
0.564mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
