ChemNet > CAS > 111373-03-6 Cyanophenylpiperazine
111373-03-6 Cyanophenylpiperazine
| שם המוצר |
Cyanophenylpiperazine |
| שם אנגלי |
Cyanophenylpiperazine; 1-(2-Cyanophenyl)piperazine; 2-(1-Piperazino)benzonitrile; 2-piperazin-1-ylbenzonitrile |
| מולקולרית פורמולה |
C11H13N3 |
| משקל מולקולרי |
187.241 |
| InChI |
InChI=1/C11H13N3/c12-9-10-3-1-2-4-11(10)14-7-5-13-6-8-14/h1-4,13H,5-8H2 |
| מספר CAS |
111373-03-6 |
| מבנה מולקולרי |
|
| צפיפות |
1.16g/cm3 |
| נקודת רתיחה |
369.4°C at 760 mmHg |
| משקל סגולי |
1.602 |
| נקודת הבזק |
177.2°C |
| לחץ אדים |
1.19E-05mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
