ChemNet > CAS > 1119-46-6 5-Chlorovaleric acid
1119-46-6 5-Chlorovaleric acid
| שם המוצר |
5-Chlorovaleric acid |
| שם אנגלי |
5-Chlorovaleric acid; 214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
| מולקולרית פורמולה |
C5H9ClO2 |
| משקל מולקולרי |
136.5768 |
| InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| מספר CAS |
1119-46-6 |
| EINECS |
214-279-3 |
| מבנה מולקולרי |
|
| צפיפות |
1.166g/cm3 |
| נקודת ההתוך |
18-20℃ |
| נקודת רתיחה |
230.9°C at 760 mmHg |
| משקל סגולי |
1.452 |
| נקודת הבזק |
93.4°C |
| לחץ אדים |
0.0227mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R34:Causes burns.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
