ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
שם המוצר |
3,5-Dibromobenzeneboronic acid |
שם אנגלי |
3,5-Dibromobenzeneboronic acid; 3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
מולקולרית פורמולה |
C6H5BBr2O2 |
משקל מולקולרי |
279.7217 |
InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
מספר CAS |
117695-55-3 |
מבנה מולקולרי |
|
צפיפות |
2.09g/cm3 |
נקודת ההתוך |
300℃ |
נקודת רתיחה |
382.8°C at 760 mmHg |
משקל סגולי |
1.651 |
נקודת הבזק |
185.3°C |
לחץ אדים |
1.52E-06mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|