124-48-1 Chlorodibromomethane
שם המוצר |
Chlorodibromomethane |
שם אנגלי |
Chlorodibromomethane; Dibromochloromethane |
מולקולרית פורמולה |
CHBr2Cl |
משקל מולקולרי |
208.2796 |
InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
מספר CAS |
124-48-1 |
EINECS |
204-704-0 |
מבנה מולקולרי |
|
צפיפות |
2.504g/cm3 |
נקודת ההתוך |
-22℃ |
נקודת רתיחה |
117.1°C at 760 mmHg |
משקל סגולי |
1.561 |
נקודת הבזק |
19.8°C |
לחץ אדים |
21mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|