ChemNet > CAS > 13455-00-0 Diphosphorus tetraiodide
13455-00-0 Diphosphorus tetraiodide
שם המוצר |
Diphosphorus tetraiodide |
שם אנגלי |
Diphosphorus tetraiodide; Phosphorus diiodide; tetraiododiphosphane |
מולקולרית פורמולה |
I4P2 |
משקל מולקולרי |
569.5654 |
InChI |
InChI=1/I4P2/c1-5(2)6(3)4 |
מספר CAS |
13455-00-0 |
EINECS |
236-646-7 |
מבנה מולקולרי |
|
נקודת ההתוך |
125-128℃ |
Hazard סימנים |
C:Corrosive;
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
S7/9:Keep container tightly closed and in a well-ventilated place.;
|
|