135-01-3 1,2-diethylbenzene
שם המוצר |
1,2-diethylbenzene |
שם אנגלי |
1,2-diethylbenzene; Diethylbenzene; o-Diethylbenzene |
מולקולרית פורמולה |
C10H14 |
משקל מולקולרי |
134.2182 |
InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
מספר CAS |
135-01-3 |
EINECS |
205-170-1 |
מבנה מולקולרי |
|
צפיפות |
0.865g/cm3 |
נקודת רתיחה |
183.5°C at 760 mmHg |
משקל סגולי |
1.496 |
נקודת הבזק |
49.4°C |
לחץ אדים |
1.05mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|